![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Adobe Atmosphere - S..> | 2002-08-02 09:25 | 264 | |
| BBC - History - 3-ds..> | 2002-08-08 07:05 | 196 | |
| Field Trips Site.url | 2002-01-31 04:41 | 130 | |
| FloorPlanPanorama.url | 2002-06-12 06:38 | 174 | |
| Going to a Museum Ho..> | 2002-11-02 16:59 | 284 | |
| Molecular Expression..> | 2002-04-30 09:41 | 291 | |
| Molecular Expression..> | 2002-06-07 14:18 | 249 | |
| ORSAY MUSEUM - entra..> | 2002-02-17 07:12 | 184 | |
| Powerhouse Museum An..> | 2002-02-17 07:12 | 166 | |
| Tenochtitlan.url | 2002-06-07 10:29 | 218 | |
| TerraServer V5.0 Hom..> | 2002-10-24 12:11 | 154 | |
| Virtual Zoo.url | 2002-02-05 09:45 | 206 | |
| Virtual Zoo Tour.url | 2002-02-05 09:46 | 132 | |
| Welcome to VRWay.url | 2002-02-17 07:36 | 174 | |
| http--www.history.or..> | 2002-02-24 14:49 | 134 | |
| http--www.smartweb.f..> | 2002-02-17 07:13 | 148 | |